C15H21FN2O3 — CID 111491170
N'-(2-fluoro-4-methylphenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide (PubChem CID 111491170) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is N'-(2-fluoro-4-methylphenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide.
| Compound Name | N'-(2-fluoro-4-methylphenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide |
|---|---|
| PubChem CID | 111491170 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N'-(2-fluoro-4-methylphenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC(C)(C)CCO)c(F)c1 |
| InChI | InChI=1S/C15H21FN2O3/c1-10-4-5-12(11(16)8-10)18-14(21)13(20)17-9-15(2,3)6-7-19/h4-5,8,19H,6-7,9H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | OHBOCNQCYRXZKD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|