C18H21FN2O4 — CID 111491156
N'-[2-fluoro-5-(furan-2-yl)phenyl]-N-(4-hydroxy-2,2-dimethylbutyl)oxamide (PubChem CID 111491156) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is N'-[2-fluoro-5-(furan-2-yl)phenyl]-N-(4-hydroxy-2,2-dimethylbutyl)oxamide.
| Compound Name | N'-[2-fluoro-5-(furan-2-yl)phenyl]-N-(4-hydroxy-2,2-dimethylbutyl)oxamide |
|---|---|
| PubChem CID | 111491156 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N'-[2-fluoro-5-(furan-2-yl)phenyl]-N-(4-hydroxy-2,2-dimethylbutyl)oxamide |
| SMILES | CC(C)(CCO)CNC(=O)C(=O)Nc1cc(-c2ccco2)ccc1F |
| InChI | InChI=1S/C18H21FN2O4/c1-18(2,7-8-22)11-20-16(23)17(24)21-14-10-12(5-6-13(14)19)15-4-3-9-25-15/h3-6,9-10,22H,7-8,11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | JJEHLILXCLIAEG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|