C14H19BrN2O3 — CID 111491139
N'-(2-bromophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide (PubChem CID 111491139) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is N'-(2-bromophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide.
| Compound Name | N'-(2-bromophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide |
|---|---|
| PubChem CID | 111491139 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N'-(2-bromophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)oxamide |
| SMILES | CC(C)(CCO)CNC(=O)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C14H19BrN2O3/c1-14(2,7-8-18)9-16-12(19)13(20)17-11-6-4-3-5-10(11)15/h3-6,18H,7-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | GCXDEJYYGQTBPU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|