C13H17BrN2O3 — CID 111121394
N'-(2-bromophenyl)-N-(2-hydroxypentyl)oxamide (PubChem CID 111121394) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is N'-(2-bromophenyl)-N-(2-hydroxypentyl)oxamide.
| Compound Name | N'-(2-bromophenyl)-N-(2-hydroxypentyl)oxamide |
|---|---|
| PubChem CID | 111121394 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N'-(2-bromophenyl)-N-(2-hydroxypentyl)oxamide |
| SMILES | CCCC(O)CNC(=O)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C13H17BrN2O3/c1-2-5-9(17)8-15-12(18)13(19)16-11-7-4-3-6-10(11)14/h3-4,6-7,9,17H,2,5,8H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | DKCNJTZKGJUHFS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|