C19H22N2O3 — CID 111121406
N'-(1,2-dihydroacenaphthylen-5-yl)-N-(2-hydroxypentyl)oxamide (PubChem CID 111121406) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-(1,2-dihydroacenaphthylen-5-yl)-N-(2-hydroxypentyl)oxamide.
| Compound Name | N'-(1,2-dihydroacenaphthylen-5-yl)-N-(2-hydroxypentyl)oxamide |
|---|---|
| PubChem CID | 111121406 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N'-(1,2-dihydroacenaphthylen-5-yl)-N-(2-hydroxypentyl)oxamide |
| SMILES | CCCC(O)CNC(=O)C(=O)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H22N2O3/c1-2-4-14(22)11-20-18(23)19(24)21-16-10-9-13-8-7-12-5-3-6-15(16)17(12)13/h3,5-6,9-10,14,22H,2,4,7-8,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | YVXTYNYBWFBPIR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|