C14H12NO2- — CID 7312561
2-(1,2-dihydroacenaphthylen-5-ylamino)acetate (PubChem CID 7312561) has the molecular formula C14H12NO2- and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-(1,2-dihydroacenaphthylen-5-ylamino)acetate.
| Compound Name | 2-(1,2-dihydroacenaphthylen-5-ylamino)acetate |
|---|---|
| PubChem CID | 7312561 |
| Molecular Formula | C14H12NO2- |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-(1,2-dihydroacenaphthylen-5-ylamino)acetate |
| SMILES | O=C([O-])CNc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C14H13NO2/c16-13(17)8-15-12-7-6-10-5-4-9-2-1-3-11(12)14(9)10/h1-3,6-7,15H,4-5,8H2,(H,16,17)/p-1 |
| InChIKey | MKCYNNHVLHLGCZ-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |