C20H16N2O3 — CID 23875149
N-(1,2-dihydroacenaphthylen-5-yl)-2-(4-nitrophenyl)acetamide (PubChem CID 23875149) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23875149 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C20H16N2O3/c23-19(12-13-4-9-16(10-5-13)22(24)25)21-18-11-8-15-7-6-14-2-1-3-17(18)20(14)15/h1-5,8-11H,6-7,12H2,(H,21,23) |
| InChIKey | DVGUGXIGZBSLAS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|