C25H21NO3S — CID 100511475
N-(1,2-dihydroacenaphthylen-5-yl)-2-(naphthalen-1-ylmethylsulfonyl)acetamide (PubChem CID 100511475) has the molecular formula C25H21NO3S and a molecular weight of 415.51 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-2-(naphthalen-1-ylmethylsulfonyl)acetamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-(naphthalen-1-ylmethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 100511475 |
| Molecular Formula | C25H21NO3S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-2-(naphthalen-1-ylmethylsulfonyl)acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1cccc2ccccc12)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C25H21NO3S/c27-24(26-23-14-13-19-12-11-18-7-4-10-22(23)25(18)19)16-30(28,29)15-20-8-3-6-17-5-1-2-9-21(17)20/h1-10,13-14H,11-12,15-16H2,(H,26,27) |
| InChIKey | ZOBGHLDWOWPOIK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |