C21H18FNO3S — CID 7544372
N-(1,2-dihydroacenaphthylen-5-yl)-3-(4-fluorophenyl)sulfonylpropanamide (PubChem CID 7544372) has the molecular formula C21H18FNO3S and a molecular weight of 383.44 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-3-(4-fluorophenyl)sulfonylpropanamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-3-(4-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 7544372 |
| Molecular Formula | C21H18FNO3S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-3-(4-fluorophenyl)sulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(F)cc1)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C21H18FNO3S/c22-16-7-9-17(10-8-16)27(25,26)13-12-20(24)23-19-11-6-15-5-4-14-2-1-3-18(19)21(14)15/h1-3,6-11H,4-5,12-13H2,(H,23,24) |
| InChIKey | LYYVYVWHZAVXEN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |