C29H28N2O4S — CID 100503541
N-(1,2-dihydroacenaphthylen-5-yl)-4-(N-methylsulfonyl-2-phenoxyanilino)butanamide (PubChem CID 100503541) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-4-(N-methylsulfonyl-2-phenoxyanilino)butanamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-4-(N-methylsulfonyl-2-phenoxyanilino)butanamide |
|---|---|
| PubChem CID | 100503541 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-4-(N-methylsulfonyl-2-phenoxyanilino)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)Nc1ccc2c3c(cccc13)CC2)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C29H28N2O4S/c1-36(33,34)31(26-13-5-6-14-27(26)35-23-10-3-2-4-11-23)20-8-15-28(32)30-25-19-18-22-17-16-21-9-7-12-24(25)29(21)22/h2-7,9-14,18-19H,8,15-17,20H2,1H3,(H,30,32) |
| InChIKey | SZWHGIWGEHSIEE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |