C23H22F2N2O4S — CID 100582106
4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-phenoxyphenyl)butanamide (PubChem CID 100582106) has the molecular formula C23H22F2N2O4S and a molecular weight of 460.50 g/mol. Its IUPAC name is 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-phenoxyphenyl)butanamide.
| Compound Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 100582106 |
| Molecular Formula | C23H22F2N2O4S |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-phenoxyphenyl)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)Nc1ccccc1Oc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H22F2N2O4S/c1-32(29,30)27(17-13-14-19(24)20(25)16-17)15-7-12-23(28)26-21-10-5-6-11-22(21)31-18-8-3-2-4-9-18/h2-6,8-11,13-14,16H,7,12,15H2,1H3,(H,26,28) |
| InChIKey | NDPJOLPJOXMXIK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |