C19H22F2N2O4S — CID 53287913
4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethoxyphenyl)butanamide (PubChem CID 53287913) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethoxyphenyl)butanamide.
| Compound Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 53287913 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccccc1NC(=O)CCCN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H22F2N2O4S/c1-3-27-18-8-5-4-7-17(18)22-19(24)9-6-12-23(28(2,25)26)14-10-11-15(20)16(21)13-14/h4-5,7-8,10-11,13H,3,6,9,12H2,1-2H3,(H,22,24) |
| InChIKey | ZILGVIFDPSKUIL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |