C21H24F2N2O5S — CID 100749655
ethyl 4-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate (PubChem CID 100749655) has the molecular formula C21H24F2N2O5S and a molecular weight of 454.50 g/mol. Its IUPAC name is ethyl 4-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate.
| Compound Name | ethyl 4-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 100749655 |
| Molecular Formula | C21H24F2N2O5S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | ethyl 4-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoylamino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCN(c2ccc(F)c(F)c2)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C21H24F2N2O5S/c1-4-30-21(27)15-7-10-19(14(2)12-15)24-20(26)6-5-11-25(31(3,28)29)16-8-9-17(22)18(23)13-16/h7-10,12-13H,4-6,11H2,1-3H3,(H,24,26) |
| InChIKey | USHLVJCLRAVGIY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |