C19H24N2O — CID 119697802
7-amino-N-(1,2-dihydroacenaphthylen-5-yl)heptanamide (PubChem CID 119697802) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 7-amino-N-(1,2-dihydroacenaphthylen-5-yl)heptanamide.
| Compound Name | 7-amino-N-(1,2-dihydroacenaphthylen-5-yl)heptanamide |
|---|---|
| PubChem CID | 119697802 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 7-amino-N-(1,2-dihydroacenaphthylen-5-yl)heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H24N2O/c20-13-4-2-1-3-8-18(22)21-17-12-11-15-10-9-14-6-5-7-16(17)19(14)15/h5-7,11-12H,1-4,8-10,13,20H2,(H,21,22) |
| InChIKey | ANFKPKDLQCISTL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|