C23H16FNO5S — CID 41151686
N-(9,10-dioxoanthracen-1-yl)-3-(4-fluorophenyl)sulfonylpropanamide (PubChem CID 41151686) has the molecular formula C23H16FNO5S and a molecular weight of 437.45 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-3-(4-fluorophenyl)sulfonylpropanamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-3-(4-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 41151686 |
| Molecular Formula | C23H16FNO5S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-3-(4-fluorophenyl)sulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(F)cc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H16FNO5S/c24-14-8-10-15(11-9-14)31(29,30)13-12-20(26)25-19-7-3-6-18-21(19)23(28)17-5-2-1-4-16(17)22(18)27/h1-11H,12-13H2,(H,25,26) |
| InChIKey | WCHOQUJFPWFULA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|