C19H17FN2O5S — CID 41274475
4-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-4-yl)butanamide (PubChem CID 41274475) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-4-yl)butanamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-4-yl)butanamide |
|---|---|
| PubChem CID | 41274475 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-4-yl)butanamide |
| SMILES | CN1C(=O)c2cccc(NC(=O)CCCS(=O)(=O)c3ccc(F)cc3)c2C1=O |
| InChI | InChI=1S/C19H17FN2O5S/c1-22-18(24)14-4-2-5-15(17(14)19(22)25)21-16(23)6-3-11-28(26,27)13-9-7-12(20)8-10-13/h2,4-5,7-10H,3,6,11H2,1H3,(H,21,23) |
| InChIKey | HJULNHBNQXHNGK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|