C23H23N4O3+ — CID 7328471
N-(1,2-dihydroacenaphthylen-5-yl)-5-nitro-2-piperazin-4-ium-1-ylbenzamide (PubChem CID 7328471) has the molecular formula C23H23N4O3+ and a molecular weight of 403.46 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-yl)-5-nitro-2-piperazin-4-ium-1-ylbenzamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-yl)-5-nitro-2-piperazin-4-ium-1-ylbenzamide |
|---|---|
| PubChem CID | 7328471 |
| Molecular Formula | C23H23N4O3+ |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-5-nitro-2-piperazin-4-ium-1-ylbenzamide |
| SMILES | O=C(Nc1ccc2c3c(cccc13)CC2)c1cc([N+](=O)[O-])ccc1N1CC[NH2+]CC1 |
| InChI | InChI=1S/C23H22N4O3/c28-23(25-20-8-6-16-5-4-15-2-1-3-18(20)22(15)16)19-14-17(27(29)30)7-9-21(19)26-12-10-24-11-13-26/h1-3,6-9,14,24H,4-5,10-13H2,(H,25,28)/p+1 |
| InChIKey | PCQPHAQADBNWDV-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|