C16H15FN4O3 — CID 111475578
1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea (PubChem CID 111475578) has the molecular formula C16H15FN4O3 and a molecular weight of 330.32 g/mol. Its IUPAC name is 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 111475578 |
| Molecular Formula | C16H15FN4O3 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[2-fluoro-5-(furan-2-yl)phenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cnn(CCO)c1)Nc1cc(-c2ccco2)ccc1F |
| InChI | InChI=1S/C16H15FN4O3/c17-13-4-3-11(15-2-1-7-24-15)8-14(13)20-16(23)19-12-9-18-21(10-12)5-6-22/h1-4,7-10,22H,5-6H2,(H2,19,20,23) |
| InChIKey | QOSCGAWYJMKMLU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |