C12H12Cl2N4O2 — CID 110911174
1-(2,5-dichlorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea (PubChem CID 110911174) has the molecular formula C12H12Cl2N4O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 110911174 |
| Molecular Formula | C12H12Cl2N4O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cnn(CCO)c1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H12Cl2N4O2/c13-8-1-2-10(14)11(5-8)17-12(20)16-9-6-15-18(7-9)3-4-19/h1-2,5-7,19H,3-4H2,(H2,16,17,20) |
| InChIKey | KLGQJNISCFMYLB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |