C13H11Cl2N3O — CID 108886244
1-(2,5-dichlorophenyl)-3-(6-methyl-3-pyridinyl)urea (PubChem CID 108886244) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(6-methyl-3-pyridinyl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 108886244 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(6-methyl-3-pyridinyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(Cl)ccc2Cl)cn1 |
| InChI | InChI=1S/C13H11Cl2N3O/c1-8-2-4-10(7-16-8)17-13(19)18-12-6-9(14)3-5-11(12)15/h2-7H,1H3,(H2,17,18,19) |
| InChIKey | NKWOWMFVMCCZTP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |