C13H14N4O — CID 102308841
1,3-bis(6-methyl-3-pyridinyl)urea (PubChem CID 102308841) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 1,3-bis(6-methyl-3-pyridinyl)urea.
| Compound Name | 1,3-bis(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 102308841 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1,3-bis(6-methyl-3-pyridinyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C)nc2)cn1 |
| InChI | InChI=1S/C13H14N4O/c1-9-3-5-11(7-14-9)16-13(18)17-12-6-4-10(2)15-8-12/h3-8H,1-2H3,(H2,16,17,18) |
| InChIKey | VDWMYCNYBDTJPL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |