C15H13N3O3S — CID 178016655
1-(1,1-dioxo-1-benzothiophen-6-yl)-3-(6-methyl-3-pyridinyl)urea (PubChem CID 178016655) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-(1,1-dioxo-1-benzothiophen-6-yl)-3-(6-methyl-3-pyridinyl)urea.
| Compound Name | 1-(1,1-dioxo-1-benzothiophen-6-yl)-3-(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 178016655 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-(1,1-dioxo-1-benzothiophen-6-yl)-3-(6-methyl-3-pyridinyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc3c(c2)S(=O)(=O)C=C3)cn1 |
| InChI | InChI=1S/C15H13N3O3S/c1-10-2-4-13(9-16-10)18-15(19)17-12-5-3-11-6-7-22(20,21)14(11)8-12/h2-9H,1H3,(H2,17,18,19) |
| InChIKey | JRIVAHAUNZZOBW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |