C16H11F2NO3S — CID 75374354
2-(2,5-difluorophenyl)-N-(1,1-dioxo-1-benzothiophen-6-yl)acetamide (PubChem CID 75374354) has the molecular formula C16H11F2NO3S and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-N-(1,1-dioxo-1-benzothiophen-6-yl)acetamide.
| Compound Name | 2-(2,5-difluorophenyl)-N-(1,1-dioxo-1-benzothiophen-6-yl)acetamide |
|---|---|
| PubChem CID | 75374354 |
| Molecular Formula | C16H11F2NO3S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-(2,5-difluorophenyl)-N-(1,1-dioxo-1-benzothiophen-6-yl)acetamide |
| SMILES | O=C(Cc1cc(F)ccc1F)Nc1ccc2c(c1)S(=O)(=O)C=C2 |
| InChI | InChI=1S/C16H11F2NO3S/c17-12-2-4-14(18)11(7-12)8-16(20)19-13-3-1-10-5-6-23(21,22)15(10)9-13/h1-7,9H,8H2,(H,19,20) |
| InChIKey | UXTUYMKKRUKITN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |