C13H14Cl2N4O — CID 167695271
1-(2-chloro-5-methylphenyl)-3-(2-chloropyrimidin-5-yl)urea;methane (PubChem CID 167695271) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is 1-(2-chloro-5-methylphenyl)-3-(2-chloropyrimidin-5-yl)urea;methane.
| Compound Name | 1-(2-chloro-5-methylphenyl)-3-(2-chloropyrimidin-5-yl)urea;methane |
|---|---|
| PubChem CID | 167695271 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-(2-chloro-5-methylphenyl)-3-(2-chloropyrimidin-5-yl)urea;methane |
| SMILES | C.Cc1ccc(Cl)c(NC(=O)Nc2cnc(Cl)nc2)c1 |
| InChI | InChI=1S/C12H10Cl2N4O.CH4/c1-7-2-3-9(13)10(4-7)18-12(19)17-8-5-15-11(14)16-6-8;/h2-6H,1H3,(H2,17,18,19);1H4 |
| InChIKey | XODPHYIEIYSLEU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |