C15H21N5O2 — CID 111111694
1-[4-(dimethylamino)-3-methylphenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea (PubChem CID 111111694) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-3-methylphenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[4-(dimethylamino)-3-methylphenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 111111694 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-[4-(dimethylamino)-3-methylphenyl]-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
| SMILES | Cc1cc(NC(=O)Nc2cnn(CCO)c2)ccc1N(C)C |
| InChI | InChI=1S/C15H21N5O2/c1-11-8-12(4-5-14(11)19(2)3)17-15(22)18-13-9-16-20(10-13)6-7-21/h4-5,8-10,21H,6-7H2,1-3H3,(H2,17,18,22) |
| InChIKey | OYLRTWXDEVIKIG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|