C16H22FN5O2 — CID 111431072
1-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(3-fluoro-4-methylphenyl)urea (PubChem CID 111431072) has the molecular formula C16H22FN5O2 and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(3-fluoro-4-methylphenyl)urea.
| Compound Name | 1-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(3-fluoro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 111431072 |
| Molecular Formula | C16H22FN5O2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(3-fluoro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cnn(CC(O)CN(C)C)c2)cc1F |
| InChI | InChI=1S/C16H22FN5O2/c1-11-4-5-12(6-15(11)17)19-16(24)20-13-7-18-22(8-13)10-14(23)9-21(2)3/h4-8,14,23H,9-10H2,1-3H3,(H2,19,20,24) |
| InChIKey | LKXVYTOTJYOGQI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |