C17H20ClN5O2 — CID 75398258
6-chloro-N-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-1H-indole-2-carboxamide (PubChem CID 75398258) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 6-chloro-N-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 75398258 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 6-chloro-N-[1-[3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-1H-indole-2-carboxamide |
| SMILES | CN(C)CC(O)Cn1cc(NC(=O)c2cc3ccc(Cl)cc3[nH]2)cn1 |
| InChI | InChI=1S/C17H20ClN5O2/c1-22(2)9-14(24)10-23-8-13(7-19-23)20-17(25)16-5-11-3-4-12(18)6-15(11)21-16/h3-8,14,21,24H,9-10H2,1-2H3,(H,20,25) |
| InChIKey | LYNBGEGFLQCBLA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |