C14H16Cl2N4O — CID 49088727
2,4-dichloro-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]benzamide (PubChem CID 49088727) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 49088727 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]benzamide |
| SMILES | CN(C)CCn1cc(NC(=O)c2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C14H16Cl2N4O/c1-19(2)5-6-20-9-11(8-17-20)18-14(21)12-4-3-10(15)7-13(12)16/h3-4,7-9H,5-6H2,1-2H3,(H,18,21) |
| InChIKey | SRXROEHITPAZIE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |