C14H16F2N4O — CID 49092977
N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3,4-difluorobenzamide (PubChem CID 49092977) has the molecular formula C14H16F2N4O and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3,4-difluorobenzamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 49092977 |
| Molecular Formula | C14H16F2N4O |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3,4-difluorobenzamide |
| SMILES | CN(C)CCn1cc(NC(=O)c2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C14H16F2N4O/c1-19(2)5-6-20-9-11(8-17-20)18-14(21)10-3-4-12(15)13(16)7-10/h3-4,7-9H,5-6H2,1-2H3,(H,18,21) |
| InChIKey | NGWXLELJXLKDLN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |