C17H23FN4O — CID 60616207
N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2-(2-fluorophenyl)-2-methylpropanamide (PubChem CID 60616207) has the molecular formula C17H23FN4O and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2-(2-fluorophenyl)-2-methylpropanamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2-(2-fluorophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 60616207 |
| Molecular Formula | C17H23FN4O |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2-(2-fluorophenyl)-2-methylpropanamide |
| SMILES | CN(C)CCn1cc(NC(=O)C(C)(C)c2ccccc2F)cn1 |
| InChI | InChI=1S/C17H23FN4O/c1-17(2,14-7-5-6-8-15(14)18)16(23)20-13-11-19-22(12-13)10-9-21(3)4/h5-8,11-12H,9-10H2,1-4H3,(H,20,23) |
| InChIKey | FKUKVJJELYGLCU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |