C16H23N5O3 — CID 95330365
1-[1-[(2S)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-methoxyphenyl)urea (PubChem CID 95330365) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-[1-[(2S)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[1-[(2S)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 95330365 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-[1-[(2S)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1cnn(C[C@@H](O)CN(C)C)c1 |
| InChI | InChI=1S/C16H23N5O3/c1-20(2)10-13(22)11-21-9-12(8-17-21)18-16(23)19-14-6-4-5-7-15(14)24-3/h4-9,13,22H,10-11H2,1-3H3,(H2,18,19,23)/t13-/m0/s1 |
| InChIKey | QXFGSEZUWZGZEM-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |