C16H24N6O3 — CID 95615911
1-[1-[(2R)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-ethoxy-3-pyridinyl)urea (PubChem CID 95615911) has the molecular formula C16H24N6O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[1-[(2R)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-ethoxy-3-pyridinyl)urea.
| Compound Name | 1-[1-[(2R)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-ethoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 95615911 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-[1-[(2R)-3-(dimethylamino)-2-hydroxypropyl]pyrazol-4-yl]-3-(2-ethoxy-3-pyridinyl)urea |
| SMILES | CCOc1ncccc1NC(=O)Nc1cnn(C[C@H](O)CN(C)C)c1 |
| InChI | InChI=1S/C16H24N6O3/c1-4-25-15-14(6-5-7-17-15)20-16(24)19-12-8-18-22(9-12)11-13(23)10-21(2)3/h5-9,13,23H,4,10-11H2,1-3H3,(H2,19,20,24)/t13-/m1/s1 |
| InChIKey | VKRTUWGUEORLLH-CYBMUJFWSA-N |
| XLogP | 1.24 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |