C12H13FN4O2 — CID 51102214
1-(3-fluorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea (PubChem CID 51102214) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 51102214 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[1-(2-hydroxyethyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1cnn(CCO)c1 |
| InChI | InChI=1S/C12H13FN4O2/c13-9-2-1-3-10(6-9)15-12(19)16-11-7-14-17(8-11)4-5-18/h1-3,6-8,18H,4-5H2,(H2,15,16,19) |
| InChIKey | LPEJVAIUHHIJCA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |