C12H12BrFN4O — CID 39854977
1-[2-(4-bromopyrazol-1-yl)ethyl]-3-(3-fluorophenyl)urea (PubChem CID 39854977) has the molecular formula C12H12BrFN4O and a molecular weight of 327.16 g/mol. Its IUPAC name is 1-[2-(4-bromopyrazol-1-yl)ethyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[2-(4-bromopyrazol-1-yl)ethyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 39854977 |
| Molecular Formula | C12H12BrFN4O |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-[2-(4-bromopyrazol-1-yl)ethyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(NCCn1cc(Br)cn1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H12BrFN4O/c13-9-7-16-18(8-9)5-4-15-12(19)17-11-3-1-2-10(14)6-11/h1-3,6-8H,4-5H2,(H2,15,17,19) |
| InChIKey | YRYFOCKTGZVDOS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |