C14H17BrN4S — CID 17269871
1-[3-(4-bromopyrazol-1-yl)propyl]-3-(3-methylphenyl)thiourea (PubChem CID 17269871) has the molecular formula C14H17BrN4S and a molecular weight of 353.29 g/mol. Its IUPAC name is 1-[3-(4-bromopyrazol-1-yl)propyl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[3-(4-bromopyrazol-1-yl)propyl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 17269871 |
| Molecular Formula | C14H17BrN4S |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 1-[3-(4-bromopyrazol-1-yl)propyl]-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NCCCn2cc(Br)cn2)c1 |
| InChI | InChI=1S/C14H17BrN4S/c1-11-4-2-5-13(8-11)18-14(20)16-6-3-7-19-10-12(15)9-17-19/h2,4-5,8-10H,3,6-7H2,1H3,(H2,16,18,20) |
| InChIKey | AUYDQUQURPLATH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|