C19H23BrN6S — CID 19334296
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(4-bromopyrazol-1-yl)propyl]thiourea (PubChem CID 19334296) has the molecular formula C19H23BrN6S and a molecular weight of 447.41 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(4-bromopyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(4-bromopyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19334296 |
| Molecular Formula | C19H23BrN6S |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(4-bromopyrazol-1-yl)propyl]thiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)NCCCn1cc(Br)cn1 |
| InChI | InChI=1S/C19H23BrN6S/c1-14-18(15(2)26(24-14)12-16-7-4-3-5-8-16)23-19(27)21-9-6-10-25-13-17(20)11-22-25/h3-5,7-8,11,13H,6,9-10,12H2,1-2H3,(H2,21,23,27) |
| InChIKey | LICNHKLJHZYIMH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|