C16H18N6O2 — CID 111104607
1-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea (PubChem CID 111104607) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea.
| Compound Name | 1-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 111104607 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(Cn2cccn2)c1)Nc1cnn(CCO)c1 |
| InChI | InChI=1S/C16H18N6O2/c23-8-7-22-12-15(10-18-22)20-16(24)19-14-4-1-3-13(9-14)11-21-6-2-5-17-21/h1-6,9-10,12,23H,7-8,11H2,(H2,19,20,24) |
| InChIKey | UFKSFCLATWUDST-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |