C17H24N4O2 — CID 111120548
1-(2-hydroxy-2,3-dimethylbutyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]urea (PubChem CID 111120548) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-(2-hydroxy-2,3-dimethylbutyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]urea.
| Compound Name | 1-(2-hydroxy-2,3-dimethylbutyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 111120548 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-(2-hydroxy-2,3-dimethylbutyl)-3-[3-(pyrazol-1-ylmethyl)phenyl]urea |
| SMILES | CC(C)C(C)(O)CNC(=O)Nc1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C17H24N4O2/c1-13(2)17(3,23)12-18-16(22)20-15-7-4-6-14(10-15)11-21-9-5-8-19-21/h4-10,13,23H,11-12H2,1-3H3,(H2,18,20,22) |
| InChIKey | PCUSGZNIAWKAOJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |