C17H19N5OS — CID 75505012
1-[3-(pyrazol-1-ylmethyl)phenyl]-3-[2-(1,3-thiazol-2-yl)propyl]urea (PubChem CID 75505012) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-[3-(pyrazol-1-ylmethyl)phenyl]-3-[2-(1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-[3-(pyrazol-1-ylmethyl)phenyl]-3-[2-(1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 75505012 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-[3-(pyrazol-1-ylmethyl)phenyl]-3-[2-(1,3-thiazol-2-yl)propyl]urea |
| SMILES | CC(CNC(=O)Nc1cccc(Cn2cccn2)c1)c1nccs1 |
| InChI | InChI=1S/C17H19N5OS/c1-13(16-18-7-9-24-16)11-19-17(23)21-15-5-2-4-14(10-15)12-22-8-3-6-20-22/h2-10,13H,11-12H2,1H3,(H2,19,21,23) |
| InChIKey | KHPPNQHYWFESAA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |