C18H17N5O3 — CID 75400123
1-[(3-hydroxybenzoyl)amino]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea (PubChem CID 75400123) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-[(3-hydroxybenzoyl)amino]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea.
| Compound Name | 1-[(3-hydroxybenzoyl)amino]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 75400123 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-[(3-hydroxybenzoyl)amino]-3-[3-(pyrazol-1-ylmethyl)phenyl]urea |
| SMILES | O=C(NNC(=O)c1cccc(O)c1)Nc1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C18H17N5O3/c24-16-7-2-5-14(11-16)17(25)21-22-18(26)20-15-6-1-4-13(10-15)12-23-9-3-8-19-23/h1-11,24H,12H2,(H,21,25)(H2,20,22,26) |
| InChIKey | ASINPLVHBTYWDD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|