C18H15ClN4O2 — CID 17468530
3-chloro-N'-[4-(pyrazol-1-ylmethyl)benzoyl]benzohydrazide (PubChem CID 17468530) has the molecular formula C18H15ClN4O2 and a molecular weight of 354.80 g/mol. Its IUPAC name is 3-chloro-N'-[4-(pyrazol-1-ylmethyl)benzoyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[4-(pyrazol-1-ylmethyl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 17468530 |
| Molecular Formula | C18H15ClN4O2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 3-chloro-N'-[4-(pyrazol-1-ylmethyl)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(Cl)c1)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C18H15ClN4O2/c19-16-4-1-3-15(11-16)18(25)22-21-17(24)14-7-5-13(6-8-14)12-23-10-2-9-20-23/h1-11H,12H2,(H,21,24)(H,22,25) |
| InChIKey | HOCAITPMSBIUSS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|