C20H20N4O2 — CID 3667212
N'-[1-(4-methoxyphenyl)ethenyl]-3-(pyrazol-1-ylmethyl)benzohydrazide (PubChem CID 3667212) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N'-[1-(4-methoxyphenyl)ethenyl]-3-(pyrazol-1-ylmethyl)benzohydrazide.
| Compound Name | N'-[1-(4-methoxyphenyl)ethenyl]-3-(pyrazol-1-ylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 3667212 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N'-[1-(4-methoxyphenyl)ethenyl]-3-(pyrazol-1-ylmethyl)benzohydrazide |
| SMILES | C=C(NNC(=O)c1cccc(Cn2cccn2)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-15(17-7-9-19(26-2)10-8-17)22-23-20(25)18-6-3-5-16(13-18)14-24-12-4-11-21-24/h3-13,22H,1,14H2,2H3,(H,23,25) |
| InChIKey | SYGDPSLXCBYBIJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|