C18H13ClF4N4O — CID 19447936
1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 19447936) has the molecular formula C18H13ClF4N4O and a molecular weight of 412.77 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19447936 |
| Molecular Formula | C18H13ClF4N4O |
| Molecular Weight | 412.77 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cnn(Cc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C18H13ClF4N4O/c19-16-7-13(20)5-4-11(16)9-27-10-15(8-24-27)26-17(28)25-14-3-1-2-12(6-14)18(21,22)23/h1-8,10H,9H2,(H2,25,26,28) |
| InChIKey | DHIFWGAGJSVFJK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.77 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |