C13H13F3N4O2 — CID 19449693
1-[1-(methoxymethyl)pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 19449693) has the molecular formula C13H13F3N4O2 and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-(methoxymethyl)pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19449693 |
| Molecular Formula | C13H13F3N4O2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-[1-(methoxymethyl)pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COCn1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C13H13F3N4O2/c1-22-8-20-7-11(6-17-20)19-12(21)18-10-4-2-3-9(5-10)13(14,15)16/h2-7H,8H2,1H3,(H2,18,19,21) |
| InChIKey | KNLJXRSSKBBSJD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |