C13H13ClFN3O2 — CID 39853882
N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-methoxyacetamide (PubChem CID 39853882) has the molecular formula C13H13ClFN3O2 and a molecular weight of 297.72 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-methoxyacetamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 39853882 |
| Molecular Formula | C13H13ClFN3O2 |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cnn(Cc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C13H13ClFN3O2/c1-20-8-13(19)17-11-5-16-18(7-11)6-9-2-3-10(15)4-12(9)14/h2-5,7H,6,8H2,1H3,(H,17,19) |
| InChIKey | SMIQREFWVLSVNX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |