C20H18ClFN4O2S — CID 19343957
ethyl 4-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]benzoate (PubChem CID 19343957) has the molecular formula C20H18ClFN4O2S and a molecular weight of 432.91 g/mol. Its IUPAC name is ethyl 4-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19343957 |
| Molecular Formula | C20H18ClFN4O2S |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | ethyl 4-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)Nc2cnn(Cc3ccc(F)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C20H18ClFN4O2S/c1-2-28-19(27)13-4-7-16(8-5-13)24-20(29)25-17-10-23-26(12-17)11-14-3-6-15(22)9-18(14)21/h3-10,12H,2,11H2,1H3,(H2,24,25,29) |
| InChIKey | GLKBUUNARFNEMV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|