C15H13ClFN5O — CID 19474621
N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 19474621) has the molecular formula C15H13ClFN5O and a molecular weight of 333.75 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19474621 |
| Molecular Formula | C15H13ClFN5O |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2cnn(Cc3ccc(F)cc3Cl)c2)cn1 |
| InChI | InChI=1S/C15H13ClFN5O/c1-21-7-11(5-18-21)15(23)20-13-6-19-22(9-13)8-10-2-3-12(17)4-14(10)16/h2-7,9H,8H2,1H3,(H,20,23) |
| InChIKey | OGDUTPNBOQSTIN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |