C18H15ClFN3O — CID 19412651
N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-phenylacetamide (PubChem CID 19412651) has the molecular formula C18H15ClFN3O and a molecular weight of 343.79 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-phenylacetamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 19412651 |
| Molecular Formula | C18H15ClFN3O |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1cnn(Cc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C18H15ClFN3O/c19-17-9-15(20)7-6-14(17)11-23-12-16(10-21-23)22-18(24)8-13-4-2-1-3-5-13/h1-7,9-10,12H,8,11H2,(H,22,24) |
| InChIKey | VNWGWAUKOAYDCO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |