C17H12ClF3N4S — CID 17300753
1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-(2,4-difluorophenyl)thiourea (PubChem CID 17300753) has the molecular formula C17H12ClF3N4S and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-(2,4-difluorophenyl)thiourea.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-(2,4-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 17300753 |
| Molecular Formula | C17H12ClF3N4S |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-3-(2,4-difluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2cnn(Cc3ccc(F)cc3Cl)c2)c(F)c1 |
| InChI | InChI=1S/C17H12ClF3N4S/c18-14-5-11(19)2-1-10(14)8-25-9-13(7-22-25)23-17(26)24-16-4-3-12(20)6-15(16)21/h1-7,9H,8H2,(H2,23,24,26) |
| InChIKey | BWIRHRVXAGNOMN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|