C28H25FN6O6S — CID 54759634
1-[4-[4-amino-7-[1-(2-hydroxyethyl)pyrazol-4-yl]thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-fluorophenyl)urea;propanedioic acid (PubChem CID 54759634) has the molecular formula C28H25FN6O6S and a molecular weight of 592.61 g/mol. Its IUPAC name is 1-[4-[4-amino-7-[1-(2-hydroxyethyl)pyrazol-4-yl]thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-fluorophenyl)urea;propanedioic acid.
| Compound Name | 1-[4-[4-amino-7-[1-(2-hydroxyethyl)pyrazol-4-yl]thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-fluorophenyl)urea;propanedioic acid |
|---|---|
| PubChem CID | 54759634 |
| Molecular Formula | C28H25FN6O6S |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 1-[4-[4-amino-7-[1-(2-hydroxyethyl)pyrazol-4-yl]thieno[3,2-c]pyridin-3-yl]phenyl]-3-(3-fluorophenyl)urea;propanedioic acid |
| SMILES | Nc1ncc(-c2cnn(CCO)c2)c2scc(-c3ccc(NC(=O)Nc4cccc(F)c4)cc3)c12.O=C(O)CC(=O)O |
| InChI | InChI=1S/C25H21FN6O2S.C3H4O4/c26-17-2-1-3-19(10-17)31-25(34)30-18-6-4-15(5-7-18)21-14-35-23-20(12-28-24(27)22(21)23)16-11-29-32(13-16)8-9-33;4-2(5)1-3(6)7/h1-7,10-14,33H,8-9H2,(H2,27,28)(H2,30,31,34);1H2,(H,4,5)(H,6,7) |
| InChIKey | NVNFPVDAPQARIY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 192.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|